2,3-Difluoro Phenylacetonitrile 2,3-Difluorobenzyl Cyanide - Names and Identifiers
Name | 2,3-difluorophenylacetonitrile
|
Synonyms | 2,3-Difluorobenzylcyanide 2,3-DIFLUOROBENZYL CYANIDE 2,3-difluorophenylacetanitrile 2,3-DIFLUOROPHENYLACETANITRILE 2,3-DIFLUOROPHENYLACETONITRILE 2,3-difluorophenylacetonitrile 2-(2,3-Difluorophenyl)acetonitrile Benzeneacetonitrile, 2,3-difluoro- (9CI) 2,3-Difluoro Phenylacetonitrile 2,3-Difluorobenzyl Cyanide
|
CAS | 145689-34-5
|
EINECS | 640-333-4 |
InChI | InChI=1/C8H5F2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 |
2,3-Difluoro Phenylacetonitrile 2,3-Difluorobenzyl Cyanide - Physico-chemical Properties
Molecular Formula | C8H5F2N
|
Molar Mass | 153.13 |
Density | 1.234±0.06 g/cm3(Predicted) |
Boling Point | 216.9±25.0 °C(Predicted) |
Flash Point | 85°C |
Vapor Presure | 0.136mmHg at 25°C |
Appearance | clear liquid |
Color | Light orange to Yellow to Green |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.485 |
2,3-Difluoro Phenylacetonitrile 2,3-Difluorobenzyl Cyanide - Risk and Safety
Hazard Symbols | T - Toxic
|
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
|
UN IDs | 3276 |
Hazard Note | Toxic |
Hazard Class | 6.1 |
Packing Group | III |
2,3-Difluoro Phenylacetonitrile 2,3-Difluorobenzyl Cyanide - Introduction
2. It is an organic compound with a chemical formula of C8H4F2N and a relative molecular mass of 149.12g/mol. Its main properties are as follows:
1. Appearance: 2. It is a colorless to light yellow liquid with a special smell.
2. Solubility: Soluble in many organic solvents, such as ethanol, ether and dimethylformamide.
3. Stability: relatively stable at room temperature, but decomposition may occur under high temperature and strong acid conditions.
4. Ignition point: 2. The ignition point of the burner is 108 ° C.
2, the main uses are as follows:
1. As an important intermediate in organic synthesis, it can be used to synthesize organic compounds such as pesticides and glyphosate.
2. In the field of medicine, it can be used as a raw material for drug synthesis, and used in anti-tumor, antibacterial and anti-inflammatory research.
2, The preparation method of fluoridation can be obtained by fluorination reaction or fluorination reaction of fluorinated sulfoxide. For example, in the presence of 2,3-fluorodiacetophenone and ammonia, 2, phosphonates are generated by a reduction reaction.
Regarding safety information, 2, the toxicity of the pill is low, but the following matters still need to be paid attention:
1. Avoid contact with skin and eyes, if contact, immediately rinse with plenty of water and seek medical help.
2. Wear appropriate protective gloves, goggles and protective clothing during use.
3. Storage should avoid contact with oxidants and strong acids and other substances to prevent dangerous reactions.
4. Operate in a well-ventilated place to avoid inhaling steam and gas.
Last Update:2024-04-09 20:02:46